* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-AMINO-1-(5-HYDROXYPENTYL)-2,3,4,5-TETRAHYDRO-1H-1-BENZAZEPIN-2-ONE |
| English Synonyms: | 7-AMINO-1-(5-HYDROXYPENTYL)-2,3,4,5-TETRAHYDRO-1H-1-BENZAZEPIN-2-ONE |
| MDL Number.: | MFCD17044175 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | c1cc2c(cc1N)CCCC(=O)N2CCCCCO |
| InChi: | InChI=1S/C15H22N2O2/c16-13-7-8-14-12(11-13)5-4-6-15(19)17(14)9-2-1-3-10-18/h7-8,11,18H,1-6,9-10,16H2 |
| InChiKey: | InChIKey=PUURQDASMVRQHI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.