* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-AMINO-6-[(5-METHYL-1,3,4-OXADIAZOL-2-YL)SULFANYL]-3,4-DIHYDRO-2H-1,4-BENZOXAZIN-3-ONE |
| English Synonyms: | 7-AMINO-6-[(5-METHYL-1,3,4-OXADIAZOL-2-YL)SULFANYL]-3,4-DIHYDRO-2H-1,4-BENZOXAZIN-3-ONE |
| MDL Number.: | MFCD17044302 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | Cc1nnc(o1)Sc2cc3c(cc2N)OCC(=O)N3 |
| InChi: | InChI=1S/C11H10N4O3S/c1-5-14-15-11(18-5)19-9-3-7-8(2-6(9)12)17-4-10(16)13-7/h2-3H,4,12H2,1H3,(H,13,16) |
| InChiKey: | InChIKey=WREFCDTYKBHVDL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.