* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC825398 |
| English Synonyms: | BCH-RESEARCH BC825398 |
| MDL Number.: | MFCD17044815 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CN(CCCC(=O)O)C(=O)c1cccc(n1)Cl |
| InChi: | InChI=1S/C11H13ClN2O3/c1-14(7-3-6-10(15)16)11(17)8-4-2-5-9(12)13-8/h2,4-5H,3,6-7H2,1H3,(H,15,16) |
| InChiKey: | InChIKey=YNDCSHHXVNZHET-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.