* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC592142 |
| English Synonyms: | BCH-RESEARCH BC592142 |
| MDL Number.: | MFCD17046391 |
| H bond acceptor: | 9 |
| H bond donor: | 4 |
| Smile: | c1cc(c(cc1[N+](=O)[O-])C(=O)NCCC(=O)N)NN |
| InChi: | InChI=1S/C10H13N5O4/c11-9(16)3-4-13-10(17)7-5-6(15(18)19)1-2-8(7)14-12/h1-2,5,14H,3-4,12H2,(H2,11,16)(H,13,17) |
| InChiKey: | InChIKey=MUDBSMFOEROMGX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.