* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 9-HYDRAZINYL-7,8-DIMETHYL-2H,3H-[1,4]DIOXINO[2,3-G]QUINOLINE |
| English Synonyms: | 9-HYDRAZINYL-7,8-DIMETHYL-2H,3H-[1,4]DIOXINO[2,3-G]QUINOLINE |
| MDL Number.: | MFCD17047019 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | Cc1c(nc2cc3c(cc2c1NN)OCCO3)C |
| InChi: | InChI=1S/C13H15N3O2/c1-7-8(2)15-10-6-12-11(17-3-4-18-12)5-9(10)13(7)16-14/h5-6H,3-4,14H2,1-2H3,(H,15,16) |
| InChiKey: | InChIKey=ZTQJQVININZRDK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.