Molecular Structure:
CCD No.:CCD03326622
SELENA SEL10657093
Formula:C15 H34 N2
MolWeight:242.448
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10657093 |
| English Synonyms： | SELENA SEL10657093 |
| MDL Number.： | MFCD17047858 |
| H bond acceptor： | 2 |
| H bond donor： | 1 |
| Smile： | CCCN(CC)CC(C)(CC)CNCC(C)C |
| InChi： | InChI=1S/C15H34N2/c1-7-10-17(9-3)13-15(6,8-2)12-16-11-14(4)5/h14,16H,7-13H2,1-6H3 |
| InChiKey： | InChIKey=YLBRSIAEACCYGX-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
