* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10658043 |
English Synonyms: | SELENA SEL10658043 |
MDL Number.: | MFCD17048807 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | Cc1c(cco1)CN(C)CC(C)(C)CNC2CC2 |
InChi: | InChI=1S/C15H26N2O/c1-12-13(7-8-18-12)9-17(4)11-15(2,3)10-16-14-5-6-14/h7-8,14,16H,5-6,9-11H2,1-4H3 |
InChiKey: | InChIKey=JQHOPVOZDUBCAR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.