* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1-(2-METHYLPENTYL)-2,3-DIHYDRO-1H-INDOLE-2,3-DIONE |
| English Synonyms: | 1-(2-METHYLPENTYL)-2,3-DIHYDRO-1H-INDOLE-2,3-DIONE |
| MDL Number.: | MFCD17049443 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | CCCC(C)CN1c2ccccc2C(=O)C1=O |
| InChi: | InChI=1S/C14H17NO2/c1-3-6-10(2)9-15-12-8-5-4-7-11(12)13(16)14(15)17/h4-5,7-8,10H,3,6,9H2,1-2H3 |
| InChiKey: | InChIKey=KXFNUZVKPCRGLK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.