* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-BENZYL-2,3,4,5-TETRAHYDRO-1-BENZOXEPIN-5-AMINE |
| English Synonyms: | 7-BENZYL-2,3,4,5-TETRAHYDRO-1-BENZOXEPIN-5-AMINE |
| MDL Number.: | MFCD17050095 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | c1ccc(cc1)Cc2ccc3c(c2)C(CCCO3)N |
| InChi: | InChI=1S/C17H19NO/c18-16-7-4-10-19-17-9-8-14(12-15(16)17)11-13-5-2-1-3-6-13/h1-3,5-6,8-9,12,16H,4,7,10-11,18H2 |
| InChiKey: | InChIKey=LXIMOHSPTBSVKZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.