* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-(BUT-2-YN-1-YLOXY)-N,2,2-TRIMETHYL-3,4-DIHYDRO-2H-1-BENZOPYRAN-4-AMINE |
| English Synonyms: | 7-(BUT-2-YN-1-YLOXY)-N,2,2-TRIMETHYL-3,4-DIHYDRO-2H-1-BENZOPYRAN-4-AMINE |
| MDL Number.: | MFCD17054628 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CC#CCOc1ccc2c(c1)OC(CC2NC)(C)C |
| InChi: | InChI=1S/C16H21NO2/c1-5-6-9-18-12-7-8-13-14(17-4)11-16(2,3)19-15(13)10-12/h7-8,10,14,17H,9,11H2,1-4H3 |
| InChiKey: | InChIKey=OPYWTQXTEXCMGK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.