* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-(METHOXYMETHYL)-2H,3H,4H-[1,4]DIOXEPINO[2,3-G]QUINOLIN-10-AMINE |
English Synonyms: | 8-(METHOXYMETHYL)-2H,3H,4H-[1,4]DIOXEPINO[2,3-G]QUINOLIN-10-AMINE |
MDL Number.: | MFCD17055196 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | COCc1cc(c2cc3c(cc2n1)OCCCO3)N |
InChi: | InChI=1S/C14H16N2O3/c1-17-8-9-5-11(15)10-6-13-14(7-12(10)16-9)19-4-2-3-18-13/h5-7H,2-4,8H2,1H3,(H2,15,16) |
InChiKey: | InChIKey=BWQXCIWMPGRFFE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.