* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC594264 |
| English Synonyms: | BCH-RESEARCH BC594264 |
| MDL Number.: | MFCD17060064 |
| H bond acceptor: | 6 |
| H bond donor: | 3 |
| Smile: | CCCNc1c(cccn1)C(=O)NCC(=O)NCC |
| InChi: | InChI=1S/C13H20N4O2/c1-3-7-15-12-10(6-5-8-16-12)13(19)17-9-11(18)14-4-2/h5-6,8H,3-4,7,9H2,1-2H3,(H,14,18)(H,15,16)(H,17,19) |
| InChiKey: | InChIKey=IQOUBXQNWPEXPN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.