* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-[2-(AZEPAN-1-YL)ETHYL]-1-PHENYLGUANIDINE |
| English Synonyms: | 3-[2-(AZEPAN-1-YL)ETHYL]-1-PHENYLGUANIDINE |
| MDL Number.: | MFCD17061172 |
| H bond acceptor: | 4 |
| H bond donor: | 3 |
| Smile: | c1ccc(cc1)NC(=N)NCCN2CCCCCC2 |
| InChi: | InChI=1S/C15H24N4/c16-15(18-14-8-4-3-5-9-14)17-10-13-19-11-6-1-2-7-12-19/h3-5,8-9H,1-2,6-7,10-13H2,(H3,16,17,18) |
| InChiKey: | InChIKey=VPKRXZUGHWHYEX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.