* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC762180 |
| English Synonyms: | BCH-RESEARCH BC762180 |
| MDL Number.: | MFCD17061885 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | CCC(CC)(CN)NS(=O)(=O)c1cn(cn1)C |
| InChi: | InChI=1S/C10H20N4O2S/c1-4-10(5-2,7-11)13-17(15,16)9-6-14(3)8-12-9/h6,8,13H,4-5,7,11H2,1-3H3 |
| InChiKey: | InChIKey=ORBBCACFDTUQGU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.