* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC591333 |
| English Synonyms: | BCH-RESEARCH BC591333 |
| MDL Number.: | MFCD17062605 |
| H bond acceptor: | 7 |
| H bond donor: | 0 |
| Smile: | c1cc2c(cc1[N+](=O)[O-])C(=O)N(S2(=O)=O)CCCCl |
| InChi: | InChI=1S/C10H9ClN2O5S/c11-4-1-5-12-10(14)8-6-7(13(15)16)2-3-9(8)19(12,17)18/h2-3,6H,1,4-5H2 |
| InChiKey: | InChIKey=FWCOTTRWCDXGJO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.