* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-(BUT-3-EN-2-YLOXY)-N,2,2-TRIMETHYL-3,4-DIHYDRO-2H-1-BENZOPYRAN-4-AMINE |
| English Synonyms: | 7-(BUT-3-EN-2-YLOXY)-N,2,2-TRIMETHYL-3,4-DIHYDRO-2H-1-BENZOPYRAN-4-AMINE |
| MDL Number.: | MFCD17062823 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CC(C=C)Oc1ccc2c(c1)OC(CC2NC)(C)C |
| InChi: | InChI=1S/C16H23NO2/c1-6-11(2)18-12-7-8-13-14(17-5)10-16(3,4)19-15(13)9-12/h6-9,11,14,17H,1,10H2,2-5H3 |
| InChiKey: | InChIKey=CVZLIXITGLCAOF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.