* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-(OXAN-4-YLMETHOXY)-2,1,3-BENZOXADIAZOL-4-AMINE |
| English Synonyms: | 7-(OXAN-4-YLMETHOXY)-2,1,3-BENZOXADIAZOL-4-AMINE |
| MDL Number.: | MFCD17062903 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | c1cc(c2c(c1N)non2)OCC3CCOCC3 |
| InChi: | InChI=1S/C12H15N3O3/c13-9-1-2-10(12-11(9)14-18-15-12)17-7-8-3-5-16-6-4-8/h1-2,8H,3-7,13H2 |
| InChiKey: | InChIKey=MMEPIOHYIUESCY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.