* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-(OXAN-4-YLMETHOXY)-1,2,3,4-TETRAHYDROQUINOLINE |
| English Synonyms: | 8-(OXAN-4-YLMETHOXY)-1,2,3,4-TETRAHYDROQUINOLINE |
| MDL Number.: | MFCD17063301 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1cc2c(c(c1)OCC3CCOCC3)NCCC2 |
| InChi: | InChI=1S/C15H21NO2/c1-3-13-4-2-8-16-15(13)14(5-1)18-11-12-6-9-17-10-7-12/h1,3,5,12,16H,2,4,6-11H2 |
| InChiKey: | InChIKey=OOCYPUQFGYUASI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.