* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH1065143 |
| English Synonyms: | FCHGROUP FCH1065143 |
| MDL Number.: | MFCD17063938 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | CCc1ccccc1CNCC2CCC=CC2 |
| InChi: | InChI=1S/C16H23N/c1-2-15-10-6-7-11-16(15)13-17-12-14-8-4-3-5-9-14/h3-4,6-7,10-11,14,17H,2,5,8-9,12-13H2,1H3 |
| InChiKey: | InChIKey=RZRORGVSGMCYPT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.