* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | DIBUTYL((1-[(PROPAN-2-YL)AMINO]BUTAN-2-YL))AMINE |
| English Synonyms: | DIBUTYL((1-[(PROPAN-2-YL)AMINO]BUTAN-2-YL))AMINE |
| MDL Number.: | MFCD17067657 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CCCCN(CCCC)C(CC)CNC(C)C |
| InChi: | InChI=1S/C15H34N2/c1-6-9-11-17(12-10-7-2)15(8-3)13-16-14(4)5/h14-16H,6-13H2,1-5H3 |
| InChiKey: | InChIKey=DOHYQTGKSSBAKA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.