* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10681384 |
English Synonyms: | SELENA SEL10681384 |
MDL Number.: | MFCD17069258 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1c(noc1CN2CCOC3C2CCC3)CN |
InChi: | InChI=1S/C12H19N3O2/c13-7-9-6-10(17-14-9)8-15-4-5-16-12-3-1-2-11(12)15/h6,11-12H,1-5,7-8,13H2 |
InChiKey: | InChIKey=ACXUHRBBOWAQIJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.