* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | OTAVA-BB 3527221 |
English Synonyms: | OTAVA-BB 3527221 |
MDL Number.: | MFCD17069613 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | c1cc(cc(c1)F)CCCC2CCNCC2 |
InChi: | InChI=1S/C14H20FN/c15-14-6-2-5-13(11-14)4-1-3-12-7-9-16-10-8-12/h2,5-6,11-12,16H,1,3-4,7-10H2 |
InChiKey: | InChIKey=ZVPHXQKSGDGSLH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.