* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | OTAVA-BB 3527224 |
English Synonyms: | OTAVA-BB 3527224 |
MDL Number.: | MFCD17069624 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | c1cc(ccc1CCCC2CCCNC2)F |
InChi: | InChI=1S/C14H20FN/c15-14-8-6-12(7-9-14)3-1-4-13-5-2-10-16-11-13/h6-9,13,16H,1-5,10-11H2 |
InChiKey: | InChIKey=JHJNRKJJXPOHTO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.