Molecular Structure:
CCD No.:CCD03347421
OTAVA-BB 3527222
Formula:C14 H20 F N
MolWeight:221.317
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 3527222 |
| English Synonyms： | OTAVA-BB 3527222 |
| MDL Number.： | MFCD17069625 |
| H bond acceptor： | 1 |
| H bond donor： | 1 |
| Smile： | c1cc(cc(c1)F)CCCC2CCCNC2 |
| InChi： | InChI=1S/C14H20FN/c15-14-8-2-5-12(10-14)4-1-6-13-7-3-9-16-11-13/h2,5,8,10,13,16H,1,3-4,6-7,9,11H2 |
| InChiKey： | InChIKey=FQECVNXYDZYTDJ-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
