* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | OTAVA-BB 3527222 |
English Synonyms: | OTAVA-BB 3527222 |
MDL Number.: | MFCD17069625 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | c1cc(cc(c1)F)CCCC2CCCNC2 |
InChi: | InChI=1S/C14H20FN/c15-14-8-2-5-12(10-14)4-1-6-13-7-3-9-16-11-13/h2,5,8,10,13,16H,1,3-4,6-7,9,11H2 |
InChiKey: | InChIKey=FQECVNXYDZYTDJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.