Molecular Structure:
CCD No.:CCD03347422
OTAVA-BB 1977399
Formula:C12 H19 N3
MolWeight:205.303
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1977399 |
| English Synonyms： | OTAVA-BB 1977399 |
| MDL Number.： | MFCD17069627 |
| H bond acceptor： | 3 |
| H bond donor： | 1 |
| Smile： | c1cnccc1C2CCN(CC2)CCN |
| InChi： | InChI=1S/C12H19N3/c13-5-10-15-8-3-12(4-9-15)11-1-6-14-7-2-11/h1-2,6-7,12H,3-5,8-10,13H2 |
| InChiKey： | InChIKey=SXPLORAOXIPBML-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
