* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 3-CHLORO-5-PHENYL-1,2,4-OXADIAZOLE |
CAS: | 23432-93-1 |
English Synonyms: | 3-CHLORO-5-PHENYL-1,2,4-OXADIAZOLE ; 1,2,4-OXADIAZOLE, 3-CHLORO-5-PHENYL- |
MDL Number.: | MFCD17078858 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | c1ccc(cc1)c2nc(no2)Cl |
InChi: | InChI=1S/C8H5ClN2O/c9-8-10-7(12-11-8)6-4-2-1-3-5-6/h1-5H |
InChiKey: | InChIKey=KQNDRQCJJPCDJO-UHFFFAOYSA-N |
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.