Molecular Structure:
CCD No.:CCD03347617
OTAVA-BB 3991127
Formula:C14 H20 N2
MolWeight:216.326
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 3991127 |
| English Synonyms： | OTAVA-BB 3991127 |
| MDL Number.： | MFCD17079013 |
| H bond acceptor： | 2 |
| H bond donor： | 1 |
| Smile： | c1ccc(cc1)CN2CC3(C2)CCCCN3 |
| InChi： | InChI=1S/C14H20N2/c1-2-6-13(7-3-1)10-16-11-14(12-16)8-4-5-9-15-14/h1-3,6-7,15H,4-5,8-12H2 |
| InChiKey： | InChIKey=FKUWMCZADBIPQK-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
