* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PROPYL((1-[2-(1H-PYRAZOL-1-YL)ETHYL]-1H-1,2,3-TRIAZOL-4-YL)METHYL)AMINE |
| English Synonyms: | PROPYL((1-[2-(1H-PYRAZOL-1-YL)ETHYL]-1H-1,2,3-TRIAZOL-4-YL)METHYL)AMINE |
| MDL Number.: | MFCD17079843 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | CCCNCc1cn(nn1)CCn2cccn2 |
| InChi: | InChI=1S/C11H18N6/c1-2-4-12-9-11-10-17(15-14-11)8-7-16-6-3-5-13-16/h3,5-6,10,12H,2,4,7-9H2,1H3 |
| InChiKey: | InChIKey=LGKYXMPNNGQVSC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.