Molecular Structure:
CCD No.:CCD03352895
OTAVA-BB 4217023
Formula:C11 H17 N3 O2 S
MolWeight:255.34
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 4217023 |
| English Synonyms： | OTAVA-BB 4217023 |
| MDL Number.： | MFCD17084587 |
| H bond acceptor： | 5 |
| H bond donor： | 1 |
| Smile： | Cc1cc(cnc1N(C)C2CCS(=O)(=O)C2)N |
| InChi： | InChI=1S/C11H17N3O2S/c1-8-5-9(12)6-13-11(8)14(2)10-3-4-17(15,16)7-10/h5-6,10H,3-4,7,12H2,1-2H3 |
| InChiKey： | InChIKey=VMZQXHATNNUXFM-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
