* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10688877 |
English Synonyms: | SELENA SEL10688877 |
MDL Number.: | MFCD17086392 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | c1ccc(c(c1)C2(CC3CC2C4C3CCC4)N)F |
InChi: | InChI=1S/C16H20FN/c17-15-7-2-1-6-13(15)16(18)9-10-8-14(16)12-5-3-4-11(10)12/h1-2,6-7,10-12,14H,3-5,8-9,18H2 |
InChiKey: | InChIKey=RSHGVRCXJAACBC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.