Molecular Structure:
CCD No.:CCD03355981
SELENA SEL10690313
Formula:C13 H17 F2 N O2 S
MolWeight:289.344
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10690313 |
| English Synonyms： | SELENA SEL10690313 |
| MDL Number.： | MFCD17087756 |
| H bond acceptor： | 3 |
| H bond donor： | 1 |
| Smile： | c1cc(c(c(c1)F)F)CC(CN)C2CCS(=O)(=O)C2 |
| InChi： | InChI=1S/C13H17F2NO2S/c14-12-3-1-2-9(13(12)15)6-11(7-16)10-4-5-19(17,18)8-10/h1-3,10-11H,4-8,16H2 |
| InChiKey： | InChIKey=JLYFGZJRICNDIT-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
