Molecular Structure:
CCD No.:CCD03355985
SELENA SEL10690317
Formula:C11 H16 Br N O2 S2
MolWeight:338.288
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10690317 |
| English Synonyms： | SELENA SEL10690317 |
| MDL Number.： | MFCD17087760 |
| H bond acceptor： | 3 |
| H bond donor： | 1 |
| Smile： | c1csc(c1Br)CC(CN)C2CCS(=O)(=O)C2 |
| InChi： | InChI=1S/C11H16BrNO2S2/c12-10-1-3-16-11(10)5-9(6-13)8-2-4-17(14,15)7-8/h1,3,8-9H,2,4-7,13H2 |
| InChiKey： | InChIKey=KZAPOFDXCHTWCM-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
