Molecular Structure:
CCD No.:CCD03356257
SELENA SEL10690617
Formula:C13 H19 N5
MolWeight:245.328
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10690617 |
| English Synonyms： | SELENA SEL10690617 |
| MDL Number.： | MFCD17088044 |
| H bond acceptor： | 5 |
| H bond donor： | 1 |
| Smile： | CCC(Cc1nnnn1c2ccccc2)CNC |
| InChi： | InChI=1S/C13H19N5/c1-3-11(10-14-2)9-13-15-16-17-18(13)12-7-5-4-6-8-12/h4-8,11,14H,3,9-10H2,1-2H3 |
| InChiKey： | InChIKey=ZSVKBBWAZFZIFL-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
