* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10692720 |
English Synonyms: | SELENA SEL10692720 |
MDL Number.: | MFCD17090139 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | Cc1ccc(s1)/C=C/C(=O)NC2(CCCCC2)CO |
InChi: | InChI=1S/C15H21NO2S/c1-12-5-6-13(19-12)7-8-14(18)16-15(11-17)9-3-2-4-10-15/h5-8,17H,2-4,9-11H2,1H3,(H,16,18)/b8-7+ |
InChiKey: | InChIKey=QCQVXSDIYVOUSE-BQYQJAHWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.