* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10692722 |
English Synonyms: | SELENA SEL10692722 |
MDL Number.: | MFCD17090141 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CN1C(=O)CCC(=N1)C(=O)NC2(CCCCC2)CO |
InChi: | InChI=1S/C13H21N3O3/c1-16-11(18)6-5-10(15-16)12(19)14-13(9-17)7-3-2-4-8-13/h17H,2-9H2,1H3,(H,14,19) |
InChiKey: | InChIKey=CNEZJUHVGJJZBI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.