* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10692752 |
English Synonyms: | SELENA SEL10692752 |
MDL Number.: | MFCD17090171 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | C1CCC(CC1)(CO)NS(=O)(=O)C2CCS(=O)(=O)C2 |
InChi: | InChI=1S/C11H21NO5S2/c13-9-11(5-2-1-3-6-11)12-19(16,17)10-4-7-18(14,15)8-10/h10,12-13H,1-9H2 |
InChiKey: | InChIKey=ONLYZGDAIPLSCD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.