Molecular Structure:
CCD No.:CCD03358371
SELENA SEL10692783
Formula:C15 H27 N3 O
MolWeight:265.398
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10692783 |
| English Synonyms： | SELENA SEL10692783 |
| MDL Number.： | MFCD17090202 |
| H bond acceptor： | 4 |
| H bond donor： | 2 |
| Smile： | CC(C)c1c(cn(n1)C)CNC2(CCCCC2)CO |
| InChi： | InChI=1S/C15H27N3O/c1-12(2)14-13(10-18(3)17-14)9-16-15(11-19)7-5-4-6-8-15/h10,12,16,19H,4-9,11H2,1-3H3 |
| InChiKey： | InChIKey=DMRTUHKHVAIDRF-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
