* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10692783 |
English Synonyms: | SELENA SEL10692783 |
MDL Number.: | MFCD17090202 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | CC(C)c1c(cn(n1)C)CNC2(CCCCC2)CO |
InChi: | InChI=1S/C15H27N3O/c1-12(2)14-13(10-18(3)17-14)9-16-15(11-19)7-5-4-6-8-15/h10,12,16,19H,4-9,11H2,1-3H3 |
InChiKey: | InChIKey=DMRTUHKHVAIDRF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.