* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10692793 |
English Synonyms: | SELENA SEL10692793 |
MDL Number.: | MFCD17090212 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | c1cn(cn1)CCCNC2(CCCCC2)CO |
InChi: | InChI=1S/C13H23N3O/c17-11-13(5-2-1-3-6-13)15-7-4-9-16-10-8-14-12-16/h8,10,12,15,17H,1-7,9,11H2 |
InChiKey: | InChIKey=QQKWALSBAGSSBB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.