* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10692803 |
English Synonyms: | SELENA SEL10692803 |
MDL Number.: | MFCD17090221 |
H bond acceptor: | 3 |
H bond donor: | 3 |
Smile: | c1cc(sc1)C(CNC2(CCCCC2)CO)O |
InChi: | InChI=1S/C13H21NO2S/c15-10-13(6-2-1-3-7-13)14-9-11(16)12-5-4-8-17-12/h4-5,8,11,14-16H,1-3,6-7,9-10H2 |
InChiKey: | InChIKey=KFGFBHJJPHXACH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.