* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10692926 |
English Synonyms: | SELENA SEL10692926 |
MDL Number.: | MFCD17090344 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CC1CCC2(CC1)CSC(=N2)NCC(C)(C)N(C)C |
InChi: | InChI=1S/C15H29N3S/c1-12-6-8-15(9-7-12)11-19-13(17-15)16-10-14(2,3)18(4)5/h12H,6-11H2,1-5H3,(H,16,17) |
InChiKey: | InChIKey=YSNSBEULDNSNLF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.