Molecular Structure:
CCD No.:CCD03358575
SELENA SEL10692989
Formula:C13 H19 N3 O3
MolWeight:265.311
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10692989 |
| English Synonyms： | SELENA SEL10692989 |
| MDL Number.： | MFCD17090406 |
| H bond acceptor： | 6 |
| H bond donor： | 3 |
| Smile： | CC1CCC(CC1)(CO)NC(=O)c2ccc(=O)[nH]n2 |
| InChi： | InChI=1S/C13H19N3O3/c1-9-4-6-13(8-17,7-5-9)14-12(19)10-2-3-11(18)16-15-10/h2-3,9,17H,4-8H2,1H3,(H,14,19)(H,16,18) |
| InChiKey： | InChIKey=QVCHUQYBTBXCRT-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
