* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10693857 |
English Synonyms: | SELENA SEL10693857 |
MDL Number.: | MFCD17091259 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | c1cc(cc(c1)Cl)Cn2c(=O)c3ccsc3nc2S |
InChi: | InChI=1S/C13H9ClN2OS2/c14-9-3-1-2-8(6-9)7-16-12(17)10-4-5-19-11(10)15-13(16)18/h1-6H,7H2,(H,15,18) |
InChiKey: | InChIKey=LGWRGXQTZNUYMC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.