Molecular Structure:
CCD No.:CCD03359388
SELENA SEL10693858
Formula:C11 H13 Cl N2 O3
MolWeight:256.688
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10693858 |
| English Synonyms： | SELENA SEL10693858 |
| MDL Number.： | MFCD17091260 |
| H bond acceptor： | 5 |
| H bond donor： | 2 |
| Smile： | CN(CC(=O)O)C(=O)NCc1cccc(c1)Cl |
| InChi： | InChI=1S/C11H13ClN2O3/c1-14(7-10(15)16)11(17)13-6-8-3-2-4-9(12)5-8/h2-5H,6-7H2,1H3,(H,13,17)(H,15,16) |
| InChiKey： | InChIKey=XZLSEAZFKRTSMD-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
