* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10693873 |
English Synonyms: | SELENA SEL10693873 |
MDL Number.: | MFCD17091275 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | CC(C)C(/C(=N/O)/N)C(=O)NCc1cccc(c1)Cl |
InChi: | InChI=1S/C13H18ClN3O2/c1-8(2)11(12(15)17-19)13(18)16-7-9-4-3-5-10(14)6-9/h3-6,8,11,19H,7H2,1-2H3,(H2,15,17)(H,16,18) |
InChiKey: | InChIKey=SYGGKNNGSQWTAH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.