Molecular Structure:
CCD No.:CCD03364245
SELENA SEL10699007
Formula:C16 H23 N3
MolWeight:257.379
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10699007 |
| English Synonyms： | SELENA SEL10699007 |
| MDL Number.： | MFCD17096334 |
| H bond acceptor： | 3 |
| H bond donor： | 1 |
| Smile： | CC(C)CNCC(C)n1ccnc1c2ccccc2 |
| InChi： | InChI=1S/C16H23N3/c1-13(2)11-17-12-14(3)19-10-9-18-16(19)15-7-5-4-6-8-15/h4-10,13-14,17H,11-12H2,1-3H3 |
| InChiKey： | InChIKey=GDCCFADHUUTZRU-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
