Molecular Structure:
CCD No.:CCD03364248
SELENA SEL10699010
Formula:C14 H17 N3
MolWeight:227.309
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10699010 |
| English Synonyms： | SELENA SEL10699010 |
| MDL Number.： | MFCD17096337 |
| H bond acceptor： | 3 |
| H bond donor： | 1 |
| Smile： | C=CCNCCn1ccnc1c2ccccc2 |
| InChi： | InChI=1S/C14H17N3/c1-2-8-15-9-11-17-12-10-16-14(17)13-6-4-3-5-7-13/h2-7,10,12,15H,1,8-9,11H2 |
| InChiKey： | InChIKey=QULJMUGFUBDQMW-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
