Molecular Structure:
CCD No.:CCD03364529
SELENA SEL10699295
Formula:C17 H27 N O
MolWeight:261.406
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10699295 |
| English Synonyms： | SELENA SEL10699295 |
| MDL Number.： | MFCD17096618 |
| H bond acceptor： | 2 |
| H bond donor： | 1 |
| Smile： | CC(C)CCNCC(C)OC/C=C/c1ccccc1 |
| InChi： | InChI=1S/C17H27NO/c1-15(2)11-12-18-14-16(3)19-13-7-10-17-8-5-4-6-9-17/h4-10,15-16,18H,11-14H2,1-3H3/b10-7+ |
| InChiKey： | InChIKey=CYHZPYJSAOKYJS-JXMROGBWSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
