Molecular Structure:
CCD No.:CCD03364531
SELENA SEL10699297
Formula:C16 H19 N O2
MolWeight:257.331
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10699297 |
| English Synonyms： | SELENA SEL10699297 |
| MDL Number.： | MFCD17096620 |
| H bond acceptor： | 3 |
| H bond donor： | 1 |
| Smile： | c1ccc(cc1)/C=C/COCCNCc2ccco2 |
| InChi： | InChI=1S/C16H19NO2/c1-2-6-15(7-3-1)8-4-11-18-13-10-17-14-16-9-5-12-19-16/h1-9,12,17H,10-11,13-14H2/b8-4+ |
| InChiKey： | InChIKey=OIZHCWHBZTUYAE-XBXARRHUSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
