Molecular Structure:
CCD No.:CCD03365332
SELENA SEL10700233
Formula:C16 H19 N O S
MolWeight:273.398
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10700233 |
| English Synonyms： | SELENA SEL10700233 |
| MDL Number.： | MFCD17097462 |
| H bond acceptor： | 2 |
| H bond donor： | 1 |
| Smile： | C=CCc1ccccc1OCCNCc2cccs2 |
| InChi： | InChI=1S/C16H19NOS/c1-2-6-14-7-3-4-9-16(14)18-11-10-17-13-15-8-5-12-19-15/h2-5,7-9,12,17H,1,6,10-11,13H2 |
| InChiKey： | InChIKey=ACNNWVIVJVIPNM-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
