Molecular Structure:
CCD No.:CCD03365613
SELENA SEL10700518
Formula:C14 H21 N O2 S2
MolWeight:299.457
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10700518 |
| English Synonyms： | SELENA SEL10700518 |
| MDL Number.： | MFCD17097743 |
| H bond acceptor： | 3 |
| H bond donor： | 1 |
| Smile： | Cc1ccc(c(c1)C)SCCNC2CCS(=O)(=O)C2 |
| InChi： | InChI=1S/C14H21NO2S2/c1-11-3-4-14(12(2)9-11)18-7-6-15-13-5-8-19(16,17)10-13/h3-4,9,13,15H,5-8,10H2,1-2H3 |
| InChiKey： | InChIKey=ISYMXUBXYULIMW-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
